C21H32N2O8 — CID 126469036
oxalic acid;N-propan-2-yl-1-[(2,3,4-trimethoxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 126469036) has the molecular formula C21H32N2O8 and a molecular weight of 440.49 g/mol. Its IUPAC name is oxalic acid;N-propan-2-yl-1-[(2,3,4-trimethoxyphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | oxalic acid;N-propan-2-yl-1-[(2,3,4-trimethoxyphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126469036 |
| Molecular Formula | C21H32N2O8 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | oxalic acid;N-propan-2-yl-1-[(2,3,4-trimethoxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(CN2CCC(C(=O)NC(C)C)CC2)c(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H30N2O4.C2H2O4/c1-13(2)20-19(22)14-8-10-21(11-9-14)12-15-6-7-16(23-3)18(25-5)17(15)24-4;3-1(4)2(5)6/h6-7,13-14H,8-12H2,1-5H3,(H,20,22);(H,3,4)(H,5,6) |
| InChIKey | YEYVESCFVBEGDH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|