C20H30N2O6 — CID 163328544
1-[(4-ethoxyphenyl)methyl]-N-propan-2-ylpiperidine-4-carboxamide;oxalic acid (PubChem CID 163328544) has the molecular formula C20H30N2O6 and a molecular weight of 394.47 g/mol. Its IUPAC name is 1-[(4-ethoxyphenyl)methyl]-N-propan-2-ylpiperidine-4-carboxamide;oxalic acid.
| Compound Name | 1-[(4-ethoxyphenyl)methyl]-N-propan-2-ylpiperidine-4-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 163328544 |
| Molecular Formula | C20H30N2O6 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 1-[(4-ethoxyphenyl)methyl]-N-propan-2-ylpiperidine-4-carboxamide;oxalic acid |
| SMILES | CCOc1ccc(CN2CCC(C(=O)NC(C)C)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H28N2O2.C2H2O4/c1-4-22-17-7-5-15(6-8-17)13-20-11-9-16(10-12-20)18(21)19-14(2)3;3-1(4)2(5)6/h5-8,14,16H,4,9-13H2,1-3H3,(H,19,21);(H,3,4)(H,5,6) |
| InChIKey | LELUMGUCCCZERP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|