C25H33ClN2O5 — CID 23441403
ethyl 4-[6-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-2,3-dimethoxyphenoxy]butanoate (PubChem CID 23441403) has the molecular formula C25H33ClN2O5 and a molecular weight of 477.00 g/mol. Its IUPAC name is ethyl 4-[6-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-2,3-dimethoxyphenoxy]butanoate.
| Compound Name | ethyl 4-[6-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-2,3-dimethoxyphenoxy]butanoate |
|---|---|
| PubChem CID | 23441403 |
| Molecular Formula | C25H33ClN2O5 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | ethyl 4-[6-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-2,3-dimethoxyphenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1c(CN2CCN(c3ccc(Cl)cc3)CC2)ccc(OC)c1OC |
| InChI | InChI=1S/C25H33ClN2O5/c1-4-32-23(29)6-5-17-33-24-19(7-12-22(30-2)25(24)31-3)18-27-13-15-28(16-14-27)21-10-8-20(26)9-11-21/h7-12H,4-6,13-18H2,1-3H3 |
| InChIKey | IFJJCZWTNJHHIG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|