C21H27ClN2O3 — CID 90477466
1-(4-chlorophenyl)-4-[2-(2,3,4-trimethoxyphenyl)ethyl]piperazine (PubChem CID 90477466) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[2-(2,3,4-trimethoxyphenyl)ethyl]piperazine.
| Compound Name | 1-(4-chlorophenyl)-4-[2-(2,3,4-trimethoxyphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 90477466 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[2-(2,3,4-trimethoxyphenyl)ethyl]piperazine |
| SMILES | COc1ccc(CCN2CCN(c3ccc(Cl)cc3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C21H27ClN2O3/c1-25-19-9-4-16(20(26-2)21(19)27-3)10-11-23-12-14-24(15-13-23)18-7-5-17(22)6-8-18/h4-9H,10-15H2,1-3H3 |
| InChIKey | TULSIGLVLQBRQG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |