C18H30Cl2N2O5 — CID 67652751
ethyl [6-[(4-ethylpiperazin-1-yl)methyl]-2,3-dimethoxyphenyl] carbonate;dihydrochloride (PubChem CID 67652751) has the molecular formula C18H30Cl2N2O5 and a molecular weight of 425.35 g/mol. Its IUPAC name is ethyl [6-[(4-ethylpiperazin-1-yl)methyl]-2,3-dimethoxyphenyl] carbonate;dihydrochloride.
| Compound Name | ethyl [6-[(4-ethylpiperazin-1-yl)methyl]-2,3-dimethoxyphenyl] carbonate;dihydrochloride |
|---|---|
| PubChem CID | 67652751 |
| Molecular Formula | C18H30Cl2N2O5 |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | ethyl [6-[(4-ethylpiperazin-1-yl)methyl]-2,3-dimethoxyphenyl] carbonate;dihydrochloride |
| SMILES | CCOC(=O)Oc1c(CN2CCN(CC)CC2)ccc(OC)c1OC.Cl.Cl |
| InChI | InChI=1S/C18H28N2O5.2ClH/c1-5-19-9-11-20(12-10-19)13-14-7-8-15(22-3)17(23-4)16(14)25-18(21)24-6-2;;/h7-8H,5-6,9-13H2,1-4H3;2*1H |
| InChIKey | OLXKBGNJMYCADL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|