C21H29BN2O5 — CID 156901880
1'-[(2R)-2-hydroxypropanoyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 156901880) has the molecular formula C21H29BN2O5 and a molecular weight of 400.28 g/mol. Its IUPAC name is 1'-[(2R)-2-hydroxypropanoyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 1'-[(2R)-2-hydroxypropanoyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 156901880 |
| Molecular Formula | C21H29BN2O5 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1'-[(2R)-2-hydroxypropanoyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | C[C@@H](O)C(=O)N1CCC2(CC1)C(=O)Nc1cc(B3OC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C21H29BN2O5/c1-13(25)17(26)24-10-8-21(9-11-24)15-7-6-14(12-16(15)23-18(21)27)22-28-19(2,3)20(4,5)29-22/h6-7,12-13,25H,8-11H2,1-5H3,(H,23,27)/t13-/m1/s1 |
| InChIKey | YMHCTTWHZLIGKB-CYBMUJFWSA-N |
| XLogP | 1.18 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|