C21H28BFN2O5 — CID 131747058
2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 131747058) has the molecular formula C21H28BFN2O5 and a molecular weight of 418.27 g/mol. Its IUPAC name is 2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 131747058 |
| Molecular Formula | C21H28BFN2O5 |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | C[C@H](O)C(=O)N1CC[C@H](Oc2ccc(B3OC(C)(C)C(C)(C)O3)cc2C#N)[C@H](F)C1 |
| InChI | InChI=1S/C21H28BFN2O5/c1-13(26)19(27)25-9-8-18(16(23)12-25)28-17-7-6-15(10-14(17)11-24)22-29-20(2,3)21(4,5)30-22/h6-7,10,13,16,18,26H,8-9,12H2,1-5H3/t13-,16+,18-/m0/s1 |
| InChIKey | WQEOPJZVIUIUKO-XCRHUMRWSA-N |
| XLogP | 1.56 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|