C23H24FN7O3S — CID 118979158
5-[4-[(2,4-dimethyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile (PubChem CID 118979158) has the molecular formula C23H24FN7O3S and a molecular weight of 497.56 g/mol. Its IUPAC name is 5-[4-[(2,4-dimethyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile.
| Compound Name | 5-[4-[(2,4-dimethyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 118979158 |
| Molecular Formula | C23H24FN7O3S |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 5-[4-[(2,4-dimethyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile |
| SMILES | Cc1nc(C)c(Nc2ncnc(-c3ccc(O[C@H]4CCN(C(=O)[C@H](C)O)C[C@H]4F)c(C#N)c3)n2)s1 |
| InChI | InChI=1S/C23H24FN7O3S/c1-12-21(35-14(3)28-12)30-23-27-11-26-20(29-23)15-4-5-18(16(8-15)9-25)34-19-6-7-31(10-17(19)24)22(33)13(2)32/h4-5,8,11,13,17,19,32H,6-7,10H2,1-3H3,(H,26,27,29,30)/t13-,17+,19-/m0/s1 |
| InChIKey | FNVPRBKVDPEQJB-IRWQIABSSA-N |
| XLogP | 2.93 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |