C22H22FN7O4S — CID 118980622
2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-5-[4-[[4-(hydroxymethyl)-1,3-thiazol-5-yl]amino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118980622) has the molecular formula C22H22FN7O4S and a molecular weight of 499.53 g/mol. Its IUPAC name is 2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-5-[4-[[4-(hydroxymethyl)-1,3-thiazol-5-yl]amino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-5-[4-[[4-(hydroxymethyl)-1,3-thiazol-5-yl]amino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118980622 |
| Molecular Formula | C22H22FN7O4S |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-5-[4-[[4-(hydroxymethyl)-1,3-thiazol-5-yl]amino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | C[C@H](O)C(=O)N1CC[C@H](Oc2ccc(-c3ncnc(Nc4scnc4CO)n3)cc2C#N)[C@H](F)C1 |
| InChI | InChI=1S/C22H22FN7O4S/c1-12(32)21(33)30-5-4-18(15(23)8-30)34-17-3-2-13(6-14(17)7-24)19-25-10-26-22(28-19)29-20-16(9-31)27-11-35-20/h2-3,6,10-12,15,18,31-32H,4-5,8-9H2,1H3,(H,25,26,28,29)/t12-,15+,18-/m0/s1 |
| InChIKey | VFLKTHYBJXRFGI-PNPHSEOMSA-N |
| XLogP | 1.80 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |