C24H26FN7O4S — CID 138514452
tert-butyl (3S,4S)-4-[2-cyano-4-[4-[[4-(hydroxymethyl)-1,3-thiazol-5-yl]amino]-1,3,5-triazin-2-yl]phenoxy]-3-fluoropiperidine-1-carboxylate (PubChem CID 138514452) has the molecular formula C24H26FN7O4S and a molecular weight of 527.58 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-[2-cyano-4-[4-[[4-(hydroxymethyl)-1,3-thiazol-5-yl]amino]-1,3,5-triazin-2-yl]phenoxy]-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-4-[2-cyano-4-[4-[[4-(hydroxymethyl)-1,3-thiazol-5-yl]amino]-1,3,5-triazin-2-yl]phenoxy]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 138514452 |
| Molecular Formula | C24H26FN7O4S |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | tert-butyl (3S,4S)-4-[2-cyano-4-[4-[[4-(hydroxymethyl)-1,3-thiazol-5-yl]amino]-1,3,5-triazin-2-yl]phenoxy]-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](Oc2ccc(-c3ncnc(Nc4scnc4CO)n3)cc2C#N)[C@@H](F)C1 |
| InChI | InChI=1S/C24H26FN7O4S/c1-24(2,3)36-23(34)32-7-6-19(16(25)10-32)35-18-5-4-14(8-15(18)9-26)20-27-12-28-22(30-20)31-21-17(11-33)29-13-37-21/h4-5,8,12-13,16,19,33H,6-7,10-11H2,1-3H3,(H,27,28,30,31)/t16-,19-/m0/s1 |
| InChIKey | UIVDITRAKLEYEO-LPHOPBHVSA-N |
| XLogP | 3.83 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |