C29H33FN8O5 — CID 139353578
5-[4-[4-[2-[amino(hydroxy)methyl]morpholin-4-yl]anilino]-1,3,5-triazin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile (PubChem CID 139353578) has the molecular formula C29H33FN8O5 and a molecular weight of 592.63 g/mol. Its IUPAC name is 5-[4-[4-[2-[amino(hydroxy)methyl]morpholin-4-yl]anilino]-1,3,5-triazin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile.
| Compound Name | 5-[4-[4-[2-[amino(hydroxy)methyl]morpholin-4-yl]anilino]-1,3,5-triazin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 139353578 |
| Molecular Formula | C29H33FN8O5 |
| Molecular Weight | 592.63 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | 5-[4-[4-[2-[amino(hydroxy)methyl]morpholin-4-yl]anilino]-1,3,5-triazin-2-yl]-2-[(3R,4S)-3-fluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxybenzonitrile |
| SMILES | C[C@H](O)C(=O)N1CC[C@H](Oc2ccc(-c3ncnc(Nc4ccc(N5CCOC(C(N)O)C5)cc4)n3)cc2C#N)[C@H](F)C1 |
| InChI | InChI=1S/C29H33FN8O5/c1-17(39)28(41)38-9-8-24(22(30)14-38)43-23-7-2-18(12-19(23)13-31)27-33-16-34-29(36-27)35-20-3-5-21(6-4-20)37-10-11-42-25(15-37)26(32)40/h2-7,12,16-17,22,24-26,39-40H,8-11,14-15,32H2,1H3,(H,33,34,35,36)/t17-,22+,24-,25?,26?/m0/s1 |
| InChIKey | PLXVJCUVDVCTOT-HAGNGPNNSA-N |
| XLogP | 1.33 |
| TPSA | 182.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.63 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|