C23H33BN2O5 — CID 140760830
tert-butyl 3-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidine-1-carboxylate (PubChem CID 140760830) has the molecular formula C23H33BN2O5 and a molecular weight of 428.34 g/mol. Its IUPAC name is tert-butyl 3-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140760830 |
| Molecular Formula | C23H33BN2O5 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | tert-butyl 3-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Oc2ccc(B3OC(C)(C)C(C)(C)O3)cc2C#N)C1 |
| InChI | InChI=1S/C23H33BN2O5/c1-21(2,3)29-20(27)26-12-8-9-18(15-26)28-19-11-10-17(13-16(19)14-25)24-30-22(4,5)23(6,7)31-24/h10-11,13,18H,8-9,12,15H2,1-7H3 |
| InChIKey | IHTZNSGLXDAYBN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|