C31H44BN3O5 — CID 153498512
1-[3-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)cyclobutyl]-1'-(oxetan-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one (PubChem CID 153498512) has the molecular formula C31H44BN3O5 and a molecular weight of 549.52 g/mol. Its IUPAC name is 1-[3-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)cyclobutyl]-1'-(oxetan-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 1-[3-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)cyclobutyl]-1'-(oxetan-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 153498512 |
| Molecular Formula | C31H44BN3O5 |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | 1-[3-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)cyclobutyl]-1'-(oxetan-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)N(C2CC(N4C5CCC4COC5)C2)C(=O)C32CCN(C3COC3)CC2)OC1(C)C |
| InChI | InChI=1S/C31H44BN3O5/c1-29(2)30(3,4)40-32(39-29)20-5-8-26-27(13-20)35(24-14-23(15-24)34-21-6-7-22(34)17-37-16-21)28(36)31(26)9-11-33(12-10-31)25-18-38-19-25/h5,8,13,21-25H,6-7,9-12,14-19H2,1-4H3 |
| InChIKey | MNXVWIFNNNJBPO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|