C21H30BNO4 — CID 162705662
1-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-oxane]-2-one (PubChem CID 162705662) has the molecular formula C21H30BNO4 and a molecular weight of 371.29 g/mol. Its IUPAC name is 1-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-oxane]-2-one.
| Compound Name | 1-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-oxane]-2-one |
|---|---|
| PubChem CID | 162705662 |
| Molecular Formula | C21H30BNO4 |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 1-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-oxane]-2-one |
| SMILES | CCCN1C(=O)C2(CCOCC2)c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C21H30BNO4/c1-6-11-23-17-14-15(22-26-19(2,3)20(4,5)27-22)7-8-16(17)21(18(23)24)9-12-25-13-10-21/h7-8,14H,6,9-13H2,1-5H3 |
| InChIKey | DNVDBBQNJHFMEC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|