C34H44B2N2O6 — CID 140849907
(3E)-3-[2-oxo-1-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-ylidene]-1-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-2-one (PubChem CID 140849907) has the molecular formula C34H44B2N2O6 and a molecular weight of 598.36 g/mol. Its IUPAC name is (3E)-3-[2-oxo-1-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-ylidene]-1-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-2-one.
| Compound Name | (3E)-3-[2-oxo-1-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-ylidene]-1-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-2-one |
|---|---|
| PubChem CID | 140849907 |
| Molecular Formula | C34H44B2N2O6 |
| Molecular Weight | 598.36 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | (3E)-3-[2-oxo-1-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-ylidene]-1-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-2-one |
| SMILES | CCCN1C(=O)/C(=C2/C(=O)N(CCC)c3cc(B4OC(C)(C)C(C)(C)O4)ccc32)c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C34H44B2N2O6/c1-11-17-37-25-19-21(35-41-31(3,4)32(5,6)42-35)13-15-23(25)27(29(37)39)28-24-16-14-22(20-26(24)38(18-12-2)30(28)40)36-43-33(7,8)34(9,10)44-36/h13-16,19-20H,11-12,17-18H2,1-10H3/b28-27+ |
| InChIKey | RKSRUNBXNLQDBH-BYYHNAKLSA-N |
| XLogP | 4.71 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|