C36H49B2NO6 — CID 101398337
1-(2-ethylhexyl)-3,4-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole-2,5-dione (PubChem CID 101398337) has the molecular formula C36H49B2NO6 and a molecular weight of 613.41 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-3,4-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-(2-ethylhexyl)-3,4-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 101398337 |
| Molecular Formula | C36H49B2NO6 |
| Molecular Weight | 613.41 g/mol |
| Exact Mass | 613.37 |
| IUPAC Name | 1-(2-ethylhexyl)-3,4-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole-2,5-dione |
| SMILES | CCCCC(CC)CN1C(=O)C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1=O |
| InChI | InChI=1S/C36H49B2NO6/c1-11-13-14-24(12-2)23-39-31(40)29(25-15-19-27(20-16-25)37-42-33(3,4)34(5,6)43-37)30(32(39)41)26-17-21-28(22-18-26)38-44-35(7,8)36(9,10)45-38/h15-22,24H,11-14,23H2,1-10H3 |
| InChIKey | VADPBRRSJIHCIY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.41 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|