C22H27NO2 — CID 157287985
2-(2-ethylhexyl)-6,7-dimethylbenzo[de]isoquinoline-1,3-dione (PubChem CID 157287985) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-6,7-dimethylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2-ethylhexyl)-6,7-dimethylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 157287985 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 2-(2-ethylhexyl)-6,7-dimethylbenzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCC(CC)CN1C(=O)c2ccc(C)c3c(C)ccc(c23)C1=O |
| InChI | InChI=1S/C22H27NO2/c1-5-7-8-16(6-2)13-23-21(24)17-11-9-14(3)19-15(4)10-12-18(20(17)19)22(23)25/h9-12,16H,5-8,13H2,1-4H3 |
| InChIKey | GZYLILHDILNXAD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|