C14H19NO3 — CID 102293952
5-(2-ethylhexyl)furo[3,4-c]pyrrole-4,6-dione (PubChem CID 102293952) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 5-(2-ethylhexyl)furo[3,4-c]pyrrole-4,6-dione.
| Compound Name | 5-(2-ethylhexyl)furo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 102293952 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 5-(2-ethylhexyl)furo[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCC(CC)CN1C(=O)c2cocc2C1=O |
| InChI | InChI=1S/C14H19NO3/c1-3-5-6-10(4-2)7-15-13(16)11-8-18-9-12(11)14(15)17/h8-10H,3-7H2,1-2H3 |
| InChIKey | ZXSRGLVZWVGGMM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|