C20H23NO2S — CID 126632900
2-(2-ethylhexyl)-6-sulfanylbenzo[de]isoquinoline-1,3-dione (PubChem CID 126632900) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-6-sulfanylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2-ethylhexyl)-6-sulfanylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 126632900 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-(2-ethylhexyl)-6-sulfanylbenzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCC(CC)CN1C(=O)c2cccc3c(S)ccc(c23)C1=O |
| InChI | InChI=1S/C20H23NO2S/c1-3-5-7-13(4-2)12-21-19(22)15-9-6-8-14-17(24)11-10-16(18(14)15)20(21)23/h6,8-11,13,24H,3-5,7,12H2,1-2H3 |
| InChIKey | KNLBQIKBKTYBGL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|