C29H42NO3P — CID 166983302
6-(3-dipropylphosphanylpropoxy)-2-(2-ethylhexyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 166983302) has the molecular formula C29H42NO3P and a molecular weight of 483.63 g/mol. Its IUPAC name is 6-(3-dipropylphosphanylpropoxy)-2-(2-ethylhexyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(3-dipropylphosphanylpropoxy)-2-(2-ethylhexyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 166983302 |
| Molecular Formula | C29H42NO3P |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 6-(3-dipropylphosphanylpropoxy)-2-(2-ethylhexyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCC(CC)CN1C(=O)c2cccc3c(OCCCP(CCC)CCC)ccc(c23)C1=O |
| InChI | InChI=1S/C29H42NO3P/c1-5-9-12-22(8-4)21-30-28(31)24-14-10-13-23-26(16-15-25(27(23)24)29(30)32)33-17-11-20-34(18-6-2)19-7-3/h10,13-16,22H,5-9,11-12,17-21H2,1-4H3 |
| InChIKey | WQVNBQIDHCDAFK-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|