C34H43NO3 — CID 137492216
2-(2-ethylhexyl)-6-octoxy-7-phenylbenzo[de]isoquinoline-1,3-dione (PubChem CID 137492216) has the molecular formula C34H43NO3 and a molecular weight of 513.72 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-6-octoxy-7-phenylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2-ethylhexyl)-6-octoxy-7-phenylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 137492216 |
| Molecular Formula | C34H43NO3 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | 2-(2-ethylhexyl)-6-octoxy-7-phenylbenzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCCCCCOc1ccc2c3c(ccc(-c4ccccc4)c13)C(=O)N(CC(CC)CCCC)C2=O |
| InChI | InChI=1S/C34H43NO3/c1-4-7-9-10-11-15-23-38-30-22-21-29-31-28(20-19-27(32(30)31)26-17-13-12-14-18-26)33(36)35(34(29)37)24-25(6-3)16-8-5-2/h12-14,17-22,25H,4-11,15-16,23-24H2,1-3H3 |
| InChIKey | WTZBKPHWQRXQMU-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|