C28H40N2O2 — CID 54531572
2-(2-ethylhexyl)-6-(2-ethylhexylamino)benzo[de]isoquinoline-1,3-dione (PubChem CID 54531572) has the molecular formula C28H40N2O2 and a molecular weight of 436.64 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-6-(2-ethylhexylamino)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2-ethylhexyl)-6-(2-ethylhexylamino)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 54531572 |
| Molecular Formula | C28H40N2O2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | 2-(2-ethylhexyl)-6-(2-ethylhexylamino)benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCC(CC)CNc1ccc2c3c(cccc13)C(=O)N(CC(CC)CCCC)C2=O |
| InChI | InChI=1S/C28H40N2O2/c1-5-9-12-20(7-3)18-29-25-17-16-24-26-22(25)14-11-15-23(26)27(31)30(28(24)32)19-21(8-4)13-10-6-2/h11,14-17,20-21,29H,5-10,12-13,18-19H2,1-4H3 |
| InChIKey | YWYGISDFQDKQBM-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|