C15H21NOS — CID 90360336
5-(2-ethylhexyl)-6-methylidenethieno[3,4-c]pyrrol-4-one (PubChem CID 90360336) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is 5-(2-ethylhexyl)-6-methylidenethieno[3,4-c]pyrrol-4-one.
| Compound Name | 5-(2-ethylhexyl)-6-methylidenethieno[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 90360336 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 5-(2-ethylhexyl)-6-methylidenethieno[3,4-c]pyrrol-4-one |
| SMILES | C=C1c2cscc2C(=O)N1CC(CC)CCCC |
| InChI | InChI=1S/C15H21NOS/c1-4-6-7-12(5-2)8-16-11(3)13-9-18-10-14(13)15(16)17/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | OBOXVDDYIOISDG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |