C32H40B2N2O2 — CID 89197009
CID 89197009 (PubChem CID 89197009) has the molecular formula C32H40B2N2O2 and a molecular weight of 506.31 g/mol.
| Compound Name | CID 89197009 |
|---|---|
| PubChem CID | 89197009 |
| Molecular Formula | C32H40B2N2O2 |
| Molecular Weight | 506.31 g/mol |
| Exact Mass | 506.33 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)N(CC(CC)CCCC)C(=O)/C2=C1/C(=O)N(CC(CC)CCCC)c2cc([B])ccc21 |
| InChI | InChI=1S/C32H40B2N2O2/c1-5-9-11-21(7-3)19-35-27-17-23(33)13-15-25(27)29(31(35)37)30-26-16-14-24(34)18-28(26)36(32(30)38)20-22(8-4)12-10-6-2/h13-18,21-22H,5-12,19-20H2,1-4H3/b30-29+ |
| InChIKey | LAIIGFODHJUHBZ-QVIHXGFCSA-N |
| XLogP | 5.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.31 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|