C48H50N2O4 — CID 176730904
(3E)-6-(1-benzofuran-2-yl)-3-[6-(1-benzofuran-2-yl)-1-(2-ethylhexyl)-2-oxoindol-3-ylidene]-1-(2-ethylhexyl)indol-2-one (PubChem CID 176730904) has the molecular formula C48H50N2O4 and a molecular weight of 718.94 g/mol. Its IUPAC name is (3E)-6-(1-benzofuran-2-yl)-3-[6-(1-benzofuran-2-yl)-1-(2-ethylhexyl)-2-oxoindol-3-ylidene]-1-(2-ethylhexyl)indol-2-one.
| Compound Name | (3E)-6-(1-benzofuran-2-yl)-3-[6-(1-benzofuran-2-yl)-1-(2-ethylhexyl)-2-oxoindol-3-ylidene]-1-(2-ethylhexyl)indol-2-one |
|---|---|
| PubChem CID | 176730904 |
| Molecular Formula | C48H50N2O4 |
| Molecular Weight | 718.94 g/mol |
| Exact Mass | 718.38 |
| IUPAC Name | (3E)-6-(1-benzofuran-2-yl)-3-[6-(1-benzofuran-2-yl)-1-(2-ethylhexyl)-2-oxoindol-3-ylidene]-1-(2-ethylhexyl)indol-2-one |
| SMILES | CCCCC(CC)CN1C(=O)/C(=C2/C(=O)N(CC(CC)CCCC)c3cc(-c4cc5ccccc5o4)ccc32)c2ccc(-c3cc4ccccc4o3)cc21 |
| InChI | InChI=1S/C48H50N2O4/c1-5-9-15-31(7-3)29-49-39-25-35(43-27-33-17-11-13-19-41(33)53-43)21-23-37(39)45(47(49)51)46-38-24-22-36(44-28-34-18-12-14-20-42(34)54-44)26-40(38)50(48(46)52)30-32(8-4)16-10-6-2/h11-14,17-28,31-32H,5-10,15-16,29-30H2,1-4H3/b46-45+ |
| InChIKey | SVPRGPMJOLXSLL-XVIFHXHVSA-N |
| XLogP | 12.55 |
| TPSA | 66.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.94 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|