C46H48N2O2S4 — CID 102490119
1,4-bis[5-(1-benzofuran-2-yl)thiophen-2-yl]-2,5-bis(2-ethylhexyl)pyrrolo[3,4-c]pyrrole-3,6-dithione (PubChem CID 102490119) has the molecular formula C46H48N2O2S4 and a molecular weight of 789.17 g/mol. Its IUPAC name is 1,4-bis[5-(1-benzofuran-2-yl)thiophen-2-yl]-2,5-bis(2-ethylhexyl)pyrrolo[3,4-c]pyrrole-3,6-dithione.
| Compound Name | 1,4-bis[5-(1-benzofuran-2-yl)thiophen-2-yl]-2,5-bis(2-ethylhexyl)pyrrolo[3,4-c]pyrrole-3,6-dithione |
|---|---|
| PubChem CID | 102490119 |
| Molecular Formula | C46H48N2O2S4 |
| Molecular Weight | 789.17 g/mol |
| Exact Mass | 788.26 |
| IUPAC Name | 1,4-bis[5-(1-benzofuran-2-yl)thiophen-2-yl]-2,5-bis(2-ethylhexyl)pyrrolo[3,4-c]pyrrole-3,6-dithione |
| SMILES | CCCCC(CC)CN1C(=S)C2=C(c3ccc(-c4cc5ccccc5o4)s3)N(CC(CC)CCCC)C(=S)C2=C1c1ccc(-c2cc3ccccc3o2)s1 |
| InChI | InChI=1S/C46H48N2O2S4/c1-5-9-15-29(7-3)27-47-43(39-23-21-37(53-39)35-25-31-17-11-13-19-33(31)49-35)41-42(45(47)51)44(48(46(41)52)28-30(8-4)16-10-6-2)40-24-22-38(54-40)36-26-32-18-12-14-20-34(32)50-36/h11-14,17-26,29-30H,5-10,15-16,27-28H2,1-4H3 |
| InChIKey | RYYFXRYAMYUPEQ-UHFFFAOYSA-N |
| XLogP | 14.48 |
| TPSA | 32.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.17 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|