C51H80N2O2 — CID 123238591
6-ethyl-3-[6-ethyl-1-(2-hexyldecyl)-2-oxoindol-3-ylidene]-1-(2-hexylnonyl)indol-2-one (PubChem CID 123238591) has the molecular formula C51H80N2O2 and a molecular weight of 753.21 g/mol. Its IUPAC name is 6-ethyl-3-[6-ethyl-1-(2-hexyldecyl)-2-oxoindol-3-ylidene]-1-(2-hexylnonyl)indol-2-one.
| Compound Name | 6-ethyl-3-[6-ethyl-1-(2-hexyldecyl)-2-oxoindol-3-ylidene]-1-(2-hexylnonyl)indol-2-one |
|---|---|
| PubChem CID | 123238591 |
| Molecular Formula | C51H80N2O2 |
| Molecular Weight | 753.21 g/mol |
| Exact Mass | 752.62 |
| IUPAC Name | 6-ethyl-3-[6-ethyl-1-(2-hexyldecyl)-2-oxoindol-3-ylidene]-1-(2-hexylnonyl)indol-2-one |
| SMILES | CCCCCCCCC(CCCCCC)CN1C(=O)C(=C2C(=O)N(CC(CCCCCC)CCCCCCC)c3cc(CC)ccc32)c2ccc(CC)cc21 |
| InChI | InChI=1S/C51H80N2O2/c1-7-13-17-21-23-27-31-43(29-25-20-16-10-4)39-53-47-37-41(12-6)33-35-45(47)49(51(53)55)48-44-34-32-40(11-5)36-46(44)52(50(48)54)38-42(28-24-19-15-9-3)30-26-22-18-14-8-2/h32-37,42-43H,7-31,38-39H2,1-6H3 |
| InChIKey | DCJZCIYPOQXPHG-UHFFFAOYSA-N |
| XLogP | 14.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.21 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|