C50H86N2O2S2Sn2 — CID 162717852
(6E)-4-(2-hexyldecyl)-6-[4-(2-hexyldecyl)-5-oxo-2-trimethylstannylthieno[3,2-b]pyrrol-6-ylidene]-2-trimethylstannylthieno[3,2-b]pyrrol-5-one (PubChem CID 162717852) has the molecular formula C50H86N2O2S2Sn2 and a molecular weight of 1048.81 g/mol. Its IUPAC name is (6E)-4-(2-hexyldecyl)-6-[4-(2-hexyldecyl)-5-oxo-2-trimethylstannylthieno[3,2-b]pyrrol-6-ylidene]-2-trimethylstannylthieno[3,2-b]pyrrol-5-one.
| Compound Name | (6E)-4-(2-hexyldecyl)-6-[4-(2-hexyldecyl)-5-oxo-2-trimethylstannylthieno[3,2-b]pyrrol-6-ylidene]-2-trimethylstannylthieno[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 162717852 |
| Molecular Formula | C50H86N2O2S2Sn2 |
| Molecular Weight | 1048.81 g/mol |
| Exact Mass | 1050.42 |
| IUPAC Name | (6E)-4-(2-hexyldecyl)-6-[4-(2-hexyldecyl)-5-oxo-2-trimethylstannylthieno[3,2-b]pyrrol-6-ylidene]-2-trimethylstannylthieno[3,2-b]pyrrol-5-one |
| SMILES | CCCCCCCCC(CCCCCC)CN1C(=O)/C(=C2/C(=O)N(CC(CCCCCC)CCCCCCCC)c3cc([Sn](C)(C)C)sc32)c2sc([Sn](C)(C)C)cc21 |
| InChI | InChI=1S/C44H68N2O2S2.6CH3.2Sn/c1-5-9-13-17-19-23-27-35(25-21-15-11-7-3)33-45-37-29-31-49-41(37)39(43(45)47)40-42-38(30-32-50-42)46(44(40)48)34-36(26-22-16-12-8-4)28-24-20-18-14-10-6-2;;;;;;;;/h29-30,35-36H,5-28,33-34H2,1-4H3;6*1H3;;/b40-39+;;;;;;;; |
| InChIKey | HQAFXXVZAFEACV-YQYJQNRPSA-N |
| XLogP | 15.18 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1048.81 |
| LogP ≤ 5 | 15.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|