C32H48B2GeO4 — CID 139037624
2-[5,5-dibutyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b][1]benzogermol-7-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 139037624) has the molecular formula C32H48B2GeO4 and a molecular weight of 590.97 g/mol. Its IUPAC name is 2-[5,5-dibutyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b][1]benzogermol-7-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[5,5-dibutyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b][1]benzogermol-7-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 139037624 |
| Molecular Formula | C32H48B2GeO4 |
| Molecular Weight | 590.97 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | 2-[5,5-dibutyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b][1]benzogermol-7-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCC[Ge]1(CCCC)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2-c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C32H48B2GeO4/c1-11-13-19-35(20-14-12-2)27-21-23(33-36-29(3,4)30(5,6)37-33)15-17-25(27)26-18-16-24(22-28(26)35)34-38-31(7,8)32(9,10)39-34/h15-18,21-22H,11-14,19-20H2,1-10H3 |
| InChIKey | ALCBGAMXYJIWPF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.97 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|