C28H40BN3O3 — CID 149248292
1-[3-(5-azaspiro[2.4]heptan-5-yl)cyclobutyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one (PubChem CID 149248292) has the molecular formula C28H40BN3O3 and a molecular weight of 477.46 g/mol. Its IUPAC name is 1-[3-(5-azaspiro[2.4]heptan-5-yl)cyclobutyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 1-[3-(5-azaspiro[2.4]heptan-5-yl)cyclobutyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 149248292 |
| Molecular Formula | C28H40BN3O3 |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | 1-[3-(5-azaspiro[2.4]heptan-5-yl)cyclobutyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)N(C2CC(N4CCC5(CC5)C4)C2)C(=O)C32CCNCC2)OC1(C)C |
| InChI | InChI=1S/C28H40BN3O3/c1-25(2)26(3,4)35-29(34-25)19-5-6-22-23(15-19)32(24(33)28(22)9-12-30-13-10-28)21-16-20(17-21)31-14-11-27(18-31)7-8-27/h5-6,15,20-21,30H,7-14,16-18H2,1-4H3 |
| InChIKey | XNNTWFBMVVGACG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|