C23H35BN2O3 — CID 174036343
1-[3-[ethyl(methyl)amino]cyclobutyl]-3,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-2-one (PubChem CID 174036343) has the molecular formula C23H35BN2O3 and a molecular weight of 398.36 g/mol. Its IUPAC name is 1-[3-[ethyl(methyl)amino]cyclobutyl]-3,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-2-one.
| Compound Name | 1-[3-[ethyl(methyl)amino]cyclobutyl]-3,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-2-one |
|---|---|
| PubChem CID | 174036343 |
| Molecular Formula | C23H35BN2O3 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 1-[3-[ethyl(methyl)amino]cyclobutyl]-3,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-2-one |
| SMILES | CCN(C)C1CC(N2C(=O)C(C)(C)c3ccc(B4OC(C)(C)C(C)(C)O4)cc32)C1 |
| InChI | InChI=1S/C23H35BN2O3/c1-9-25(8)16-13-17(14-16)26-19-12-15(10-11-18(19)21(2,3)20(26)27)24-28-22(4,5)23(6,7)29-24/h10-12,16-17H,9,13-14H2,1-8H3 |
| InChIKey | BHSMGCGUISZTSN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|