C20H28BNO3 — CID 172647443
6-azaspiro[2.5]octan-6-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (PubChem CID 172647443) has the molecular formula C20H28BNO3 and a molecular weight of 341.26 g/mol. Its IUPAC name is 6-azaspiro[2.5]octan-6-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone.
| Compound Name | 6-azaspiro[2.5]octan-6-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 172647443 |
| Molecular Formula | C20H28BNO3 |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 6-azaspiro[2.5]octan-6-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| SMILES | CC1(C)OB(c2ccc(C(=O)N3CCC4(CC3)CC4)cc2)OC1(C)C |
| InChI | InChI=1S/C20H28BNO3/c1-18(2)19(3,4)25-21(24-18)16-7-5-15(6-8-16)17(23)22-13-11-20(9-10-20)12-14-22/h5-8H,9-14H2,1-4H3 |
| InChIKey | VUSLWAIGZNFTFC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|