C16H19BN2O3 — CID 175068072
imidazol-1-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (PubChem CID 175068072) has the molecular formula C16H19BN2O3 and a molecular weight of 298.15 g/mol. Its IUPAC name is imidazol-1-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone.
| Compound Name | imidazol-1-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 175068072 |
| Molecular Formula | C16H19BN2O3 |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | imidazol-1-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| SMILES | CC1(C)OB(c2ccc(C(=O)n3ccnc3)cc2)OC1(C)C |
| InChI | InChI=1S/C16H19BN2O3/c1-15(2)16(3,4)22-17(21-15)13-7-5-12(6-8-13)14(20)19-10-9-18-11-19/h5-11H,1-4H3 |
| InChIKey | DFLYJRLFYZJRHA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|