C16H19BN2O4 — CID 175068132
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] imidazole-1-carboxylate (PubChem CID 175068132) has the molecular formula C16H19BN2O4 and a molecular weight of 314.15 g/mol. Its IUPAC name is [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] imidazole-1-carboxylate.
| Compound Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] imidazole-1-carboxylate |
|---|---|
| PubChem CID | 175068132 |
| Molecular Formula | C16H19BN2O4 |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] imidazole-1-carboxylate |
| SMILES | CC1(C)OB(c2ccc(OC(=O)n3ccnc3)cc2)OC1(C)C |
| InChI | InChI=1S/C16H19BN2O4/c1-15(2)16(3,4)23-17(22-15)12-5-7-13(8-6-12)21-14(20)19-10-9-18-11-19/h5-11H,1-4H3 |
| InChIKey | SNGNCIICNDUJGL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|