C11H12N2O — CID 175909573
2'-deuteriospiro[1H-indole-3,4'-pyrrolidine]-2-one (PubChem CID 175909573) has the molecular formula C11H12N2O and a molecular weight of 189.24 g/mol. Its IUPAC name is 2'-deuteriospiro[1H-indole-3,4'-pyrrolidine]-2-one.
| Compound Name | 2'-deuteriospiro[1H-indole-3,4'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 175909573 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 2'-deuteriospiro[1H-indole-3,4'-pyrrolidine]-2-one |
| SMILES | [2H]C1CC2(CN1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C11H12N2O/c14-10-11(5-6-12-7-11)8-3-1-2-4-9(8)13-10/h1-4,12H,5-7H2,(H,13,14)/i6D |
| InChIKey | FQSHLSLQUHZOMV-RAMDWTOOSA-N |
| XLogP | 0.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |