C19H13NO5 — CID 95166651
(3R)-4'-[hydroxy-(4-methylphenyl)methylidene]spiro[1H-indole-3,5'-oxolane]-2,2',3'-trione (PubChem CID 95166651) has the molecular formula C19H13NO5 and a molecular weight of 335.32 g/mol. Its IUPAC name is (3R)-4'-[hydroxy-(4-methylphenyl)methylidene]spiro[1H-indole-3,5'-oxolane]-2,2',3'-trione.
| Compound Name | (3R)-4'-[hydroxy-(4-methylphenyl)methylidene]spiro[1H-indole-3,5'-oxolane]-2,2',3'-trione |
|---|---|
| PubChem CID | 95166651 |
| Molecular Formula | C19H13NO5 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (3R)-4'-[hydroxy-(4-methylphenyl)methylidene]spiro[1H-indole-3,5'-oxolane]-2,2',3'-trione |
| SMILES | Cc1ccc(C(O)=C2C(=O)C(=O)O[C@@]23C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C19H13NO5/c1-10-6-8-11(9-7-10)15(21)14-16(22)17(23)25-19(14)12-4-2-3-5-13(12)20-18(19)24/h2-9,21H,1H3,(H,20,24)/t19-/m1/s1 |
| InChIKey | HGRFLNCXVNDGKJ-LJQANCHMSA-N |
| XLogP | 2.24 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|