C18H17N3O4 — CID 22013003
2-[3-[(4-methylphenyl)carbamoylamino]-2-oxo-1H-indol-3-yl]acetic acid (PubChem CID 22013003) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-[3-[(4-methylphenyl)carbamoylamino]-2-oxo-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[3-[(4-methylphenyl)carbamoylamino]-2-oxo-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 22013003 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-[3-[(4-methylphenyl)carbamoylamino]-2-oxo-1H-indol-3-yl]acetic acid |
| SMILES | Cc1ccc(NC(=O)NC2(CC(=O)O)C(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C18H17N3O4/c1-11-6-8-12(9-7-11)19-17(25)21-18(10-15(22)23)13-4-2-3-5-14(13)20-16(18)24/h2-9H,10H2,1H3,(H,20,24)(H,22,23)(H2,19,21,25) |
| InChIKey | QMAZZHHPJFVLNS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |