C22H20N2O — CID 132839196
(3R)-3-anilino-3-[(4-methylphenyl)methyl]-1H-indol-2-one (PubChem CID 132839196) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is (3R)-3-anilino-3-[(4-methylphenyl)methyl]-1H-indol-2-one.
| Compound Name | (3R)-3-anilino-3-[(4-methylphenyl)methyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 132839196 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (3R)-3-anilino-3-[(4-methylphenyl)methyl]-1H-indol-2-one |
| SMILES | Cc1ccc(C[C@]2(Nc3ccccc3)C(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C22H20N2O/c1-16-11-13-17(14-12-16)15-22(24-18-7-3-2-4-8-18)19-9-5-6-10-20(19)23-21(22)25/h2-14,24H,15H2,1H3,(H,23,25)/t22-/m1/s1 |
| InChIKey | VTTGEVSFPXGTAR-JOCHJYFZSA-N |
| XLogP | 4.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |