C19H9BrO6 — CID 5292128
(4'E)-4'-[(3-bromophenyl)-hydroxymethylidene]spiro[indene-2,5'-oxolane]-1,2',3,3'-tetrone (PubChem CID 5292128) has the molecular formula C19H9BrO6 and a molecular weight of 413.18 g/mol. Its IUPAC name is (4'E)-4'-[(3-bromophenyl)-hydroxymethylidene]spiro[indene-2,5'-oxolane]-1,2',3,3'-tetrone.
| Compound Name | (4'E)-4'-[(3-bromophenyl)-hydroxymethylidene]spiro[indene-2,5'-oxolane]-1,2',3,3'-tetrone |
|---|---|
| PubChem CID | 5292128 |
| Molecular Formula | C19H9BrO6 |
| Molecular Weight | 413.18 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | (4'E)-4'-[(3-bromophenyl)-hydroxymethylidene]spiro[indene-2,5'-oxolane]-1,2',3,3'-tetrone |
| SMILES | O=C1OC2(C(=O)c3ccccc3C2=O)/C(=C(\O)c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C19H9BrO6/c20-10-5-3-4-9(8-10)14(21)13-15(22)18(25)26-19(13)16(23)11-6-1-2-7-12(11)17(19)24/h1-8,21H/b14-13- |
| InChIKey | YFVHFWLSEIVUPG-YPKPFQOOSA-N |
| XLogP | 2.66 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.18 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|