C18H13F3O2 — CID 102487045
(2R)-2,4-diphenyl-2-(trifluoromethyl)-3H-pyran-6-one (PubChem CID 102487045) has the molecular formula C18H13F3O2 and a molecular weight of 318.29 g/mol. Its IUPAC name is (2R)-2,4-diphenyl-2-(trifluoromethyl)-3H-pyran-6-one.
| Compound Name | (2R)-2,4-diphenyl-2-(trifluoromethyl)-3H-pyran-6-one |
|---|---|
| PubChem CID | 102487045 |
| Molecular Formula | C18H13F3O2 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (2R)-2,4-diphenyl-2-(trifluoromethyl)-3H-pyran-6-one |
| SMILES | O=C1C=C(c2ccccc2)C[C@@](c2ccccc2)(C(F)(F)F)O1 |
| InChI | InChI=1S/C18H13F3O2/c19-18(20,21)17(15-9-5-2-6-10-15)12-14(11-16(22)23-17)13-7-3-1-4-8-13/h1-11H,12H2/t17-/m1/s1 |
| InChIKey | CVWWQEBRDQZBGX-QGZVFWFLSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |