C22H13F3O3 — CID 141229863
2-phenyl-2-(trifluoromethyl)-8-oxatricyclo[8.2.2.23,6]hexadeca-1(12),3(16),4,6(15),10,13-hexaene-7,9-dione (PubChem CID 141229863) has the molecular formula C22H13F3O3 and a molecular weight of 382.34 g/mol. Its IUPAC name is 2-phenyl-2-(trifluoromethyl)-8-oxatricyclo[8.2.2.23,6]hexadeca-1(12),3(16),4,6(15),10,13-hexaene-7,9-dione.
| Compound Name | 2-phenyl-2-(trifluoromethyl)-8-oxatricyclo[8.2.2.23,6]hexadeca-1(12),3(16),4,6(15),10,13-hexaene-7,9-dione |
|---|---|
| PubChem CID | 141229863 |
| Molecular Formula | C22H13F3O3 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-phenyl-2-(trifluoromethyl)-8-oxatricyclo[8.2.2.23,6]hexadeca-1(12),3(16),4,6(15),10,13-hexaene-7,9-dione |
| SMILES | O=C1OC(=O)c2ccc(cc2)C(c2ccccc2)(C(F)(F)F)c2ccc1cc2 |
| InChI | InChI=1S/C22H13F3O3/c23-22(24,25)21(16-4-2-1-3-5-16)17-10-6-14(7-11-17)19(26)28-20(27)15-8-12-18(21)13-9-15/h1-13H |
| InChIKey | CSXGWVBOLUBHMQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|