C11H6F6O3 — CID 88602325
2-benzofuran-1,3-dione;1,1,1,2,2,3-hexafluoropropane (PubChem CID 88602325) has the molecular formula C11H6F6O3 and a molecular weight of 300.15 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;1,1,1,2,2,3-hexafluoropropane.
| Compound Name | 2-benzofuran-1,3-dione;1,1,1,2,2,3-hexafluoropropane |
|---|---|
| PubChem CID | 88602325 |
| Molecular Formula | C11H6F6O3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2-benzofuran-1,3-dione;1,1,1,2,2,3-hexafluoropropane |
| SMILES | FCC(F)(F)C(F)(F)F.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H4O3.C3H2F6/c9-7-5-3-1-2-4-6(5)8(10)11-7;4-1-2(5,6)3(7,8)9/h1-4H;1H2 |
| InChIKey | NCFGYPOGEXKQTM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|