C24H21F3O — CID 15180812
2,3,6,7-tetramethyl-9-phenyl-9-(trifluoromethyl)xanthene (PubChem CID 15180812) has the molecular formula C24H21F3O and a molecular weight of 382.43 g/mol. Its IUPAC name is 2,3,6,7-tetramethyl-9-phenyl-9-(trifluoromethyl)xanthene.
| Compound Name | 2,3,6,7-tetramethyl-9-phenyl-9-(trifluoromethyl)xanthene |
|---|---|
| PubChem CID | 15180812 |
| Molecular Formula | C24H21F3O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2,3,6,7-tetramethyl-9-phenyl-9-(trifluoromethyl)xanthene |
| SMILES | Cc1cc2c(cc1C)C(c1ccccc1)(C(F)(F)F)c1cc(C)c(C)cc1O2 |
| InChI | InChI=1S/C24H21F3O/c1-14-10-19-21(12-16(14)3)28-22-13-17(4)15(2)11-20(22)23(19,24(25,26)27)18-8-6-5-7-9-18/h5-13H,1-4H3 |
| InChIKey | DMSIZYLMPQILRK-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |