C17H12F6O — CID 142358340
2,3-dimethyl-9,9-bis(trifluoromethyl)xanthene (PubChem CID 142358340) has the molecular formula C17H12F6O and a molecular weight of 346.27 g/mol. Its IUPAC name is 2,3-dimethyl-9,9-bis(trifluoromethyl)xanthene.
| Compound Name | 2,3-dimethyl-9,9-bis(trifluoromethyl)xanthene |
|---|---|
| PubChem CID | 142358340 |
| Molecular Formula | C17H12F6O |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2,3-dimethyl-9,9-bis(trifluoromethyl)xanthene |
| SMILES | Cc1cc2c(cc1C)C(C(F)(F)F)(C(F)(F)F)c1ccccc1O2 |
| InChI | InChI=1S/C17H12F6O/c1-9-7-12-14(8-10(9)2)24-13-6-4-3-5-11(13)15(12,16(18,19)20)17(21,22)23/h3-8H,1-2H3 |
| InChIKey | YOVGMGAGOVCIEY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |