C17H11F3O3S — CID 134928701
methyl 2-(trifluoromethyl)spiro[thiirane-3,9'-xanthene]-2-carboxylate (PubChem CID 134928701) has the molecular formula C17H11F3O3S and a molecular weight of 352.33 g/mol. Its IUPAC name is methyl 2-(trifluoromethyl)spiro[thiirane-3,9'-xanthene]-2-carboxylate.
| Compound Name | methyl 2-(trifluoromethyl)spiro[thiirane-3,9'-xanthene]-2-carboxylate |
|---|---|
| PubChem CID | 134928701 |
| Molecular Formula | C17H11F3O3S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | methyl 2-(trifluoromethyl)spiro[thiirane-3,9'-xanthene]-2-carboxylate |
| SMILES | COC(=O)C1(C(F)(F)F)SC12c1ccccc1Oc1ccccc12 |
| InChI | InChI=1S/C17H11F3O3S/c1-22-14(21)16(17(18,19)20)15(24-16)10-6-2-4-8-12(10)23-13-9-5-3-7-11(13)15/h2-9H,1H3 |
| InChIKey | KHUJNQTVYOLPBW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|