methyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate

C17H13F3O2S — CID 134927987

IUPACmethyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate
SMILESCOC(=O)C1(C(F)(F)F)SC1(c1ccccc1)c1ccccc1
InChIInChI=1S/C17H13F3O2S/c1-22-14(21)16(17(18,19)20)15(23-16,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3
InChIKeyXUJACKCKKGVTMB-UHFFFAOYSA-N
MW338.35 g/mol
LogP4.15
Rot. Bonds3

About methyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate

methyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate (PubChem CID 134927987) has the molecular formula C17H13F3O2S and a molecular weight of 338.35 g/mol. Its IUPAC name is methyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate.

Molecular Properties

Compound Namemethyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate
PubChem CID134927987
Molecular FormulaC17H13F3O2S
Molecular Weight338.35 g/mol
Exact Mass338.06
IUPAC Namemethyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate
SMILESCOC(=O)C1(C(F)(F)F)SC1(c1ccccc1)c1ccccc1
InChIInChI=1S/C17H13F3O2S/c1-22-14(21)16(17(18,19)20)15(23-16,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3
InChIKeyXUJACKCKKGVTMB-UHFFFAOYSA-N
XLogP4.15
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500338.35
LogP ≤ 54.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze methyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate?
The IUPAC name of methyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate (CID 134927987) is methyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate.
What is the SMILES notation for methyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate?
The canonical SMILES for methyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate is COC(=O)C1(C(F)(F)F)SC1(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate?
The InChIKey is XUJACKCKKGVTMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3O2S/c1-22-14(21)16(17(18,19)20)15(23-16,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3.
What are the key properties of methyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate?
methyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate has a molecular weight of 338.35 g/mol, XLogP of 4.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate is sourced from PubChem (CID 134927987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).