C13H14F3NO2 — CID 177326818
methyl 3-phenyl-3-(trifluoromethyl)pyrrolidine-1-carboxylate (PubChem CID 177326818) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is methyl 3-phenyl-3-(trifluoromethyl)pyrrolidine-1-carboxylate.
| Compound Name | methyl 3-phenyl-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177326818 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | methyl 3-phenyl-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(c2ccccc2)(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H14F3NO2/c1-19-11(18)17-8-7-12(9-17,13(14,15)16)10-5-3-2-4-6-10/h2-6H,7-9H2,1H3 |
| InChIKey | UQFYJKNANCLUDV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |