C20H19F3O4 — CID 177493653
dimethyl 6-methyl-4-phenyl-4-(trifluoromethyl)-1,3-dihydropentalene-2,2-dicarboxylate (PubChem CID 177493653) has the molecular formula C20H19F3O4 and a molecular weight of 380.36 g/mol. Its IUPAC name is dimethyl 6-methyl-4-phenyl-4-(trifluoromethyl)-1,3-dihydropentalene-2,2-dicarboxylate.
| Compound Name | dimethyl 6-methyl-4-phenyl-4-(trifluoromethyl)-1,3-dihydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 177493653 |
| Molecular Formula | C20H19F3O4 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | dimethyl 6-methyl-4-phenyl-4-(trifluoromethyl)-1,3-dihydropentalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C(C1)C(c1ccccc1)(C(F)(F)F)C=C2C |
| InChI | InChI=1S/C20H19F3O4/c1-12-9-19(20(21,22)23,13-7-5-4-6-8-13)15-11-18(10-14(12)15,16(24)26-2)17(25)27-3/h4-9H,10-11H2,1-3H3 |
| InChIKey | VCMJOCDZVHZCCQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|