C23H26O5 — CID 101396220
dimethyl (3aZ,9Z)-4,9-dimethyl-8-oxo-6-phenyl-3,5,6,7-tetrahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate (PubChem CID 101396220) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is dimethyl (3aZ,9Z)-4,9-dimethyl-8-oxo-6-phenyl-3,5,6,7-tetrahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aZ,9Z)-4,9-dimethyl-8-oxo-6-phenyl-3,5,6,7-tetrahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101396220 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | dimethyl (3aZ,9Z)-4,9-dimethyl-8-oxo-6-phenyl-3,5,6,7-tetrahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C(\C)CC(c3ccccc3)CC(=O)/C(C)=C\2C1 |
| InChI | InChI=1S/C23H26O5/c1-14-10-17(16-8-6-5-7-9-16)11-20(24)15(2)19-13-23(12-18(14)19,21(25)27-3)22(26)28-4/h5-9,17H,10-13H2,1-4H3/b18-14-,19-15- |
| InChIKey | YQVPHYLNYGAWSA-DJTQBEGKSA-N |
| XLogP | 3.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|