About 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol
9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol (PubChem CID 71681967) has the molecular formula C22H11F9O3
and a molecular weight of 494.31 g/mol. Its IUPAC name is 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol.
Molecular Properties
| Compound Name | 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol |
| PubChem CID | 71681967 |
| Molecular Formula | C22H11F9O3 |
| Molecular Weight | 494.31 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol |
| SMILES | Oc1ccc2c(c1)C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(C(F)(F)F)c1cc(O)ccc1O2 |
| InChI | InChI=1S/C22H11F9O3/c23-20(24,25)11-5-10(6-12(7-11)21(26,27)28)19(22(29,30)31)15-8-13(32)1-3-17(15)34-18-4-2-14(33)9-16(18)19/h1-9,32-33H |
| InChIKey | OVZBUQNGKSCEBE-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.31 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol?
The IUPAC name of 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol (CID 71681967) is 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol.
What is the SMILES notation for 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol?
The canonical SMILES for 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol is Oc1ccc2c(c1)C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(C(F)(F)F)c1cc(O)ccc1O2.
What is the InChIKey of 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol?
The InChIKey is OVZBUQNGKSCEBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H11F9O3/c23-20(24,25)11-5-10(6-12(7-11)21(26,27)28)19(22(29,30)31)15-8-13(32)1-3-17(15)34-18-4-2-14(33)9-16(18)19/h1-9,32-33H.
What are the key properties of 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol?
9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol has a molecular weight of 494.31 g/mol, XLogP of 7.14, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol is sourced from PubChem (CID 71681967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).