C22H11F9O3 — CID 71681967
9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol (PubChem CID 71681967) has the molecular formula C22H11F9O3 and a molecular weight of 494.31 g/mol. Its IUPAC name is 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol.
| Compound Name | 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol |
|---|---|
| PubChem CID | 71681967 |
| Molecular Formula | C22H11F9O3 |
| Molecular Weight | 494.31 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 9-[3,5-bis(trifluoromethyl)phenyl]-9-(trifluoromethyl)xanthene-2,7-diol |
| SMILES | Oc1ccc2c(c1)C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(C(F)(F)F)c1cc(O)ccc1O2 |
| InChI | InChI=1S/C22H11F9O3/c23-20(24,25)11-5-10(6-12(7-11)21(26,27)28)19(22(29,30)31)15-8-13(32)1-3-17(15)34-18-4-2-14(33)9-16(18)19/h1-9,32-33H |
| InChIKey | OVZBUQNGKSCEBE-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.31 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |